C10H15ClN2O2 — CID 104830824
6-chloro-3-(3,3-dimethylbutan-2-yl)-1H-pyrimidine-2,4-dione (PubChem CID 104830824) has the molecular formula C10H15ClN2O2 and a molecular weight of 230.69 g/mol. Its IUPAC name is 6-chloro-3-(3,3-dimethylbutan-2-yl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-chloro-3-(3,3-dimethylbutan-2-yl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 104830824 |
| Molecular Formula | C10H15ClN2O2 |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 6-chloro-3-(3,3-dimethylbutan-2-yl)-1H-pyrimidine-2,4-dione |
| SMILES | CC(n1c(=O)cc(Cl)[nH]c1=O)C(C)(C)C |
| InChI | InChI=1S/C10H15ClN2O2/c1-6(10(2,3)4)13-8(14)5-7(11)12-9(13)15/h5-6H,1-4H3,(H,12,15) |
| InChIKey | SYDVXGZUGNVBAT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |