C14H15N3O2S — CID 107806707
1-(1,3-benzothiazol-6-yl)-3,3,6-trimethylpiperazine-2,5-dione (PubChem CID 107806707) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-6-yl)-3,3,6-trimethylpiperazine-2,5-dione.
| Compound Name | 1-(1,3-benzothiazol-6-yl)-3,3,6-trimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 107806707 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 1-(1,3-benzothiazol-6-yl)-3,3,6-trimethylpiperazine-2,5-dione |
| SMILES | CC1C(=O)NC(C)(C)C(=O)N1c1ccc2ncsc2c1 |
| InChI | InChI=1S/C14H15N3O2S/c1-8-12(18)16-14(2,3)13(19)17(8)9-4-5-10-11(6-9)20-7-15-10/h4-8H,1-3H3,(H,16,18) |
| InChIKey | ZVHHAYZKHQENRK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |