C17H16N2O4S — CID 90733220
(4R,5S,7R)-2-(1,3-benzothiazol-6-yl)-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol (PubChem CID 90733220) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is (4R,5S,7R)-2-(1,3-benzothiazol-6-yl)-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol.
| Compound Name | (4R,5S,7R)-2-(1,3-benzothiazol-6-yl)-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol |
|---|---|
| PubChem CID | 90733220 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | (4R,5S,7R)-2-(1,3-benzothiazol-6-yl)-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol |
| SMILES | C[C@]12C[C@H](O)[C@](C)(O1)c1c2c(O)n(-c2ccc3ncsc3c2)c1O |
| InChI | InChI=1S/C17H16N2O4S/c1-16-6-11(20)17(2,23-16)13-12(16)14(21)19(15(13)22)8-3-4-9-10(5-8)24-7-18-9/h3-5,7,11,20-22H,6H2,1-2H3/t11-,16+,17-/m0/s1 |
| InChIKey | DMLIWCIJXXZOPB-JECHBYEQSA-N |
| XLogP | 2.72 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |