C16H15ClN2OS — CID 107800028
1-[1-(1,3-benzothiazol-6-yl)-2,5-dimethylpyrrol-3-yl]-2-chloropropan-1-one (PubChem CID 107800028) has the molecular formula C16H15ClN2OS and a molecular weight of 318.83 g/mol. Its IUPAC name is 1-[1-(1,3-benzothiazol-6-yl)-2,5-dimethylpyrrol-3-yl]-2-chloropropan-1-one.
| Compound Name | 1-[1-(1,3-benzothiazol-6-yl)-2,5-dimethylpyrrol-3-yl]-2-chloropropan-1-one |
|---|---|
| PubChem CID | 107800028 |
| Molecular Formula | C16H15ClN2OS |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 1-[1-(1,3-benzothiazol-6-yl)-2,5-dimethylpyrrol-3-yl]-2-chloropropan-1-one |
| SMILES | Cc1cc(C(=O)C(C)Cl)c(C)n1-c1ccc2ncsc2c1 |
| InChI | InChI=1S/C16H15ClN2OS/c1-9-6-13(16(20)10(2)17)11(3)19(9)12-4-5-14-15(7-12)21-8-18-14/h4-8,10H,1-3H3 |
| InChIKey | URASXDVBPUBBKU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|