C15H13Br3ClNO — CID 43328380
2-chloro-1-[2,5-dimethyl-1-(2,4,6-tribromophenyl)pyrrol-3-yl]propan-1-one (PubChem CID 43328380) has the molecular formula C15H13Br3ClNO and a molecular weight of 498.44 g/mol. Its IUPAC name is 2-chloro-1-[2,5-dimethyl-1-(2,4,6-tribromophenyl)pyrrol-3-yl]propan-1-one.
| Compound Name | 2-chloro-1-[2,5-dimethyl-1-(2,4,6-tribromophenyl)pyrrol-3-yl]propan-1-one |
|---|---|
| PubChem CID | 43328380 |
| Molecular Formula | C15H13Br3ClNO |
| Molecular Weight | 498.44 g/mol |
| Exact Mass | 494.82 |
| IUPAC Name | 2-chloro-1-[2,5-dimethyl-1-(2,4,6-tribromophenyl)pyrrol-3-yl]propan-1-one |
| SMILES | Cc1cc(C(=O)C(C)Cl)c(C)n1-c1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C15H13Br3ClNO/c1-7-4-11(15(21)8(2)19)9(3)20(7)14-12(17)5-10(16)6-13(14)18/h4-6,8H,1-3H3 |
| InChIKey | PIRPEKDUBDCZQH-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.44 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|