C17H19BrClNO — CID 81289143
1-[1-(4-bromo-2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-chloropropan-1-one (PubChem CID 81289143) has the molecular formula C17H19BrClNO and a molecular weight of 368.70 g/mol. Its IUPAC name is 1-[1-(4-bromo-2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-chloropropan-1-one.
| Compound Name | 1-[1-(4-bromo-2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-chloropropan-1-one |
|---|---|
| PubChem CID | 81289143 |
| Molecular Formula | C17H19BrClNO |
| Molecular Weight | 368.70 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 1-[1-(4-bromo-2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-chloropropan-1-one |
| SMILES | CCc1cc(Br)ccc1-n1c(C)cc(C(=O)C(C)Cl)c1C |
| InChI | InChI=1S/C17H19BrClNO/c1-5-13-9-14(18)6-7-16(13)20-10(2)8-15(12(20)4)17(21)11(3)19/h6-9,11H,5H2,1-4H3 |
| InChIKey | ZGQBFKGNCRXPEU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.70 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|