C16H16Br2ClNO — CID 43328379
2-chloro-1-[1-(2,6-dibromo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]propan-1-one (PubChem CID 43328379) has the molecular formula C16H16Br2ClNO and a molecular weight of 433.57 g/mol. Its IUPAC name is 2-chloro-1-[1-(2,6-dibromo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]propan-1-one.
| Compound Name | 2-chloro-1-[1-(2,6-dibromo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]propan-1-one |
|---|---|
| PubChem CID | 43328379 |
| Molecular Formula | C16H16Br2ClNO |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 430.93 |
| IUPAC Name | 2-chloro-1-[1-(2,6-dibromo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]propan-1-one |
| SMILES | Cc1cc(Br)c(-n2c(C)cc(C(=O)C(C)Cl)c2C)c(Br)c1 |
| InChI | InChI=1S/C16H16Br2ClNO/c1-8-5-13(17)15(14(18)6-8)20-9(2)7-12(11(20)4)16(21)10(3)19/h5-7,10H,1-4H3 |
| InChIKey | SUMDIUDVXSRMSC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|