C16H17ClFNO2 — CID 114840429
2-chloro-1-[1-(4-fluoro-3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]propan-1-one (PubChem CID 114840429) has the molecular formula C16H17ClFNO2 and a molecular weight of 309.77 g/mol. Its IUPAC name is 2-chloro-1-[1-(4-fluoro-3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]propan-1-one.
| Compound Name | 2-chloro-1-[1-(4-fluoro-3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]propan-1-one |
|---|---|
| PubChem CID | 114840429 |
| Molecular Formula | C16H17ClFNO2 |
| Molecular Weight | 309.77 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 2-chloro-1-[1-(4-fluoro-3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]propan-1-one |
| SMILES | COc1cc(-n2c(C)cc(C(=O)C(C)Cl)c2C)ccc1F |
| InChI | InChI=1S/C16H17ClFNO2/c1-9-7-13(16(20)10(2)17)11(3)19(9)12-5-6-14(18)15(8-12)21-4/h5-8,10H,1-4H3 |
| InChIKey | QVGIGPVDCQHVLX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.77 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|