C11H8N4O2S — CID 114003282
1-(1,3-benzothiazol-6-yl)-5-methyltriazole-4-carboxylic acid (PubChem CID 114003282) has the molecular formula C11H8N4O2S and a molecular weight of 260.28 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-6-yl)-5-methyltriazole-4-carboxylic acid.
| Compound Name | 1-(1,3-benzothiazol-6-yl)-5-methyltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 114003282 |
| Molecular Formula | C11H8N4O2S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 1-(1,3-benzothiazol-6-yl)-5-methyltriazole-4-carboxylic acid |
| SMILES | Cc1c(C(=O)O)nnn1-c1ccc2ncsc2c1 |
| InChI | InChI=1S/C11H8N4O2S/c1-6-10(11(16)17)13-14-15(6)7-2-3-8-9(4-7)18-5-12-8/h2-5H,1H3,(H,16,17) |
| InChIKey | KBHJKHKZAMKSIP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |