About 1-(1,3-benzothiazol-6-yl)-4-hydroxypyrazole-3-carboxylic acid
1-(1,3-benzothiazol-6-yl)-4-hydroxypyrazole-3-carboxylic acid (PubChem CID 107806439) has the molecular formula C11H7N3O3S
and a molecular weight of 261.26 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-6-yl)-4-hydroxypyrazole-3-carboxylic acid.
Analyze 1-(1,3-benzothiazol-6-yl)-4-hydroxypyrazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-benzothiazol-6-yl)-4-hydroxypyrazole-3-carboxylic acid?
The IUPAC name of 1-(1,3-benzothiazol-6-yl)-4-hydroxypyrazole-3-carboxylic acid (CID 107806439) is 1-(1,3-benzothiazol-6-yl)-4-hydroxypyrazole-3-carboxylic acid.
What is the SMILES notation for 1-(1,3-benzothiazol-6-yl)-4-hydroxypyrazole-3-carboxylic acid?
The canonical SMILES for 1-(1,3-benzothiazol-6-yl)-4-hydroxypyrazole-3-carboxylic acid is O=C(O)c1nn(-c2ccc3ncsc3c2)cc1O.
What is the InChIKey of 1-(1,3-benzothiazol-6-yl)-4-hydroxypyrazole-3-carboxylic acid?
The InChIKey is FVGJTOFROFRIFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3O3S/c15-8-4-14(13-10(8)11(16)17)6-1-2-7-9(3-6)18-5-12-7/h1-5,15H,(H,16,17).
What are the key properties of 1-(1,3-benzothiazol-6-yl)-4-hydroxypyrazole-3-carboxylic acid?
1-(1,3-benzothiazol-6-yl)-4-hydroxypyrazole-3-carboxylic acid has a molecular weight of 261.26 g/mol, XLogP of 1.89, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzothiazol-6-yl)-4-hydroxypyrazole-3-carboxylic acid is sourced from PubChem (CID 107806439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).