C18H21N5OS2 — CID 51273943
N-[2-(dimethylamino)-2-phenylethyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide (PubChem CID 51273943) has the molecular formula C18H21N5OS2 and a molecular weight of 387.53 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-phenylethyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide.
| Compound Name | N-[2-(dimethylamino)-2-phenylethyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 51273943 |
| Molecular Formula | C18H21N5OS2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | N-[2-(dimethylamino)-2-phenylethyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
| SMILES | CN(C)C(CNC(=O)Cn1c(-c2cccs2)n[nH]c1=S)c1ccccc1 |
| InChI | InChI=1S/C18H21N5OS2/c1-22(2)14(13-7-4-3-5-8-13)11-19-16(24)12-23-17(20-21-18(23)25)15-9-6-10-26-15/h3-10,14H,11-12H2,1-2H3,(H,19,24)(H,21,25) |
| InChIKey | HRXYVLMLOUEQPN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 65.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|