C16H14N6OS2 — CID 18105191
N-(1H-benzimidazol-2-ylmethyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide (PubChem CID 18105191) has the molecular formula C16H14N6OS2 and a molecular weight of 370.46 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 18105191 |
| Molecular Formula | C16H14N6OS2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
| SMILES | O=C(Cn1c(-c2cccs2)n[nH]c1=S)NCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H14N6OS2/c23-14(17-8-13-18-10-4-1-2-5-11(10)19-13)9-22-15(20-21-16(22)24)12-6-3-7-25-12/h1-7H,8-9H2,(H,17,23)(H,18,19)(H,21,24) |
| InChIKey | IUAKQZMPDVGOFE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|