C23H32N4O2S — CID 8865534
N-butyl-2-[4-[2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]acetyl]piperazin-1-yl]acetamide (PubChem CID 8865534) has the molecular formula C23H32N4O2S and a molecular weight of 428.60 g/mol. Its IUPAC name is N-butyl-2-[4-[2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]acetyl]piperazin-1-yl]acetamide.
| Compound Name | N-butyl-2-[4-[2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]acetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 8865534 |
| Molecular Formula | C23H32N4O2S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | N-butyl-2-[4-[2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]acetyl]piperazin-1-yl]acetamide |
| SMILES | CCCCNC(=O)CN1CCN(C(=O)CN[C@H](c2ccccc2)c2cccs2)CC1 |
| InChI | InChI=1S/C23H32N4O2S/c1-2-3-11-24-21(28)18-26-12-14-27(15-13-26)22(29)17-25-23(20-10-7-16-30-20)19-8-5-4-6-9-19/h4-10,16,23,25H,2-3,11-15,17-18H2,1H3,(H,24,28)/t23-/m1/s1 |
| InChIKey | YGMKLMAOOUXBKC-HSZRJFAPSA-N |
| XLogP | 2.49 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|