C25H34N4O2 — CID 8641041
2-[4-[2-[[(R)-(4-methylphenyl)-phenylmethyl]amino]acetyl]piperazin-1-yl]-N-propylacetamide (PubChem CID 8641041) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 2-[4-[2-[[(R)-(4-methylphenyl)-phenylmethyl]amino]acetyl]piperazin-1-yl]-N-propylacetamide.
| Compound Name | 2-[4-[2-[[(R)-(4-methylphenyl)-phenylmethyl]amino]acetyl]piperazin-1-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 8641041 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 2-[4-[2-[[(R)-(4-methylphenyl)-phenylmethyl]amino]acetyl]piperazin-1-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)CN1CCN(C(=O)CN[C@H](c2ccccc2)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C25H34N4O2/c1-3-13-26-23(30)19-28-14-16-29(17-15-28)24(31)18-27-25(21-7-5-4-6-8-21)22-11-9-20(2)10-12-22/h4-12,25,27H,3,13-19H2,1-2H3,(H,26,30)/t25-/m1/s1 |
| InChIKey | LNCHPPBKUYMTDF-RUZDIDTESA-N |
| XLogP | 2.34 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |