C19H19ClN4O2S — CID 46525977
2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(2-propoxyphenyl)acetamide (PubChem CID 46525977) has the molecular formula C19H19ClN4O2S and a molecular weight of 402.91 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(2-propoxyphenyl)acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(2-propoxyphenyl)acetamide |
|---|---|
| PubChem CID | 46525977 |
| Molecular Formula | C19H19ClN4O2S |
| Molecular Weight | 402.91 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(2-propoxyphenyl)acetamide |
| SMILES | CCCOc1ccccc1NC(=O)Cn1c(-c2ccc(Cl)cc2)n[nH]c1=S |
| InChI | InChI=1S/C19H19ClN4O2S/c1-2-11-26-16-6-4-3-5-15(16)21-17(25)12-24-18(22-23-19(24)27)13-7-9-14(20)10-8-13/h3-10H,2,11-12H2,1H3,(H,21,25)(H,23,27) |
| InChIKey | BNTFUCBEURGNEB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.91 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|