C20H20ClFN4O2S — CID 42572463
2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[4-(4-fluorophenoxy)butyl]acetamide (PubChem CID 42572463) has the molecular formula C20H20ClFN4O2S and a molecular weight of 434.92 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[4-(4-fluorophenoxy)butyl]acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[4-(4-fluorophenoxy)butyl]acetamide |
|---|---|
| PubChem CID | 42572463 |
| Molecular Formula | C20H20ClFN4O2S |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[4-(4-fluorophenoxy)butyl]acetamide |
| SMILES | O=C(Cn1c(-c2ccc(Cl)cc2)n[nH]c1=S)NCCCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C20H20ClFN4O2S/c21-15-5-3-14(4-6-15)19-24-25-20(29)26(19)13-18(27)23-11-1-2-12-28-17-9-7-16(22)8-10-17/h3-10H,1-2,11-13H2,(H,23,27)(H,25,29) |
| InChIKey | SXLRHCZCJHQWKU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|