C22H24FN5O3S — CID 24668487
N-[2-[[2-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]ethyl]-3-fluoro-4-methylbenzamide (PubChem CID 24668487) has the molecular formula C22H24FN5O3S and a molecular weight of 457.53 g/mol. Its IUPAC name is N-[2-[[2-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]ethyl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[2-[[2-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]ethyl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 24668487 |
| Molecular Formula | C22H24FN5O3S |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | N-[2-[[2-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]ethyl]-3-fluoro-4-methylbenzamide |
| SMILES | CCOc1ccc(-c2n[nH]c(=S)n2CC(=O)NCCNC(=O)c2ccc(C)c(F)c2)cc1 |
| InChI | InChI=1S/C22H24FN5O3S/c1-3-31-17-8-6-15(7-9-17)20-26-27-22(32)28(20)13-19(29)24-10-11-25-21(30)16-5-4-14(2)18(23)12-16/h4-9,12H,3,10-11,13H2,1-2H3,(H,24,29)(H,25,30)(H,27,32) |
| InChIKey | PSZKQDLRGAKPTJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 101.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|