C15H20N4O2S — CID 30789698
3-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-ethylpropanamide (PubChem CID 30789698) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is 3-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-ethylpropanamide.
| Compound Name | 3-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-ethylpropanamide |
|---|---|
| PubChem CID | 30789698 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 3-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-ethylpropanamide |
| SMILES | CCNC(=O)CCn1c(-c2ccc(OCC)cc2)n[nH]c1=S |
| InChI | InChI=1S/C15H20N4O2S/c1-3-16-13(20)9-10-19-14(17-18-15(19)22)11-5-7-12(8-6-11)21-4-2/h5-8H,3-4,9-10H2,1-2H3,(H,16,20)(H,18,22) |
| InChIKey | VPUSAOGKBUMXSE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|