C23H25N5O2S2 — CID 46653455
N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide (PubChem CID 46653455) has the molecular formula C23H25N5O2S2 and a molecular weight of 467.62 g/mol. Its IUPAC name is N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide.
| Compound Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide |
|---|---|
| PubChem CID | 46653455 |
| Molecular Formula | C23H25N5O2S2 |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide |
| SMILES | CCOc1ccc(-c2n[nH]c(=S)n2CCC(=O)NCCSCc2ccccc2C#N)cc1 |
| InChI | InChI=1S/C23H25N5O2S2/c1-2-30-20-9-7-17(8-10-20)22-26-27-23(31)28(22)13-11-21(29)25-12-14-32-16-19-6-4-3-5-18(19)15-24/h3-10H,2,11-14,16H2,1H3,(H,25,29)(H,27,31) |
| InChIKey | LDACOTYJVJUNBY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 95.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|