C25H31N5O3S — CID 43057575
3-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(2-morpholin-4-yl-2-phenylethyl)propanamide (PubChem CID 43057575) has the molecular formula C25H31N5O3S and a molecular weight of 481.62 g/mol. Its IUPAC name is 3-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(2-morpholin-4-yl-2-phenylethyl)propanamide.
| Compound Name | 3-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(2-morpholin-4-yl-2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 43057575 |
| Molecular Formula | C25H31N5O3S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 3-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(2-morpholin-4-yl-2-phenylethyl)propanamide |
| SMILES | CCOc1ccc(-c2n[nH]c(=S)n2CCC(=O)NCC(c2ccccc2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C25H31N5O3S/c1-2-33-21-10-8-20(9-11-21)24-27-28-25(34)30(24)13-12-23(31)26-18-22(19-6-4-3-5-7-19)29-14-16-32-17-15-29/h3-11,22H,2,12-18H2,1H3,(H,26,31)(H,28,34) |
| InChIKey | DFPHKCRRLLLNTC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 84.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|