C18H19N5O2S — CID 24538062
2-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(4-methyl-2-pyridinyl)acetamide (PubChem CID 24538062) has the molecular formula C18H19N5O2S and a molecular weight of 369.45 g/mol. Its IUPAC name is 2-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(4-methyl-2-pyridinyl)acetamide.
| Compound Name | 2-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(4-methyl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 24538062 |
| Molecular Formula | C18H19N5O2S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 2-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(4-methyl-2-pyridinyl)acetamide |
| SMILES | CCOc1ccc(-c2n[nH]c(=S)n2CC(=O)Nc2cc(C)ccn2)cc1 |
| InChI | InChI=1S/C18H19N5O2S/c1-3-25-14-6-4-13(5-7-14)17-21-22-18(26)23(17)11-16(24)20-15-10-12(2)8-9-19-15/h4-10H,3,11H2,1-2H3,(H,22,26)(H,19,20,24) |
| InChIKey | YUPNIGNKEHKQEG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|