C23H27N5O5S — CID 25442692
4-butoxy-3-methoxy-N'-[2-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]benzohydrazide (PubChem CID 25442692) has the molecular formula C23H27N5O5S and a molecular weight of 485.57 g/mol. Its IUPAC name is 4-butoxy-3-methoxy-N'-[2-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]benzohydrazide.
| Compound Name | 4-butoxy-3-methoxy-N'-[2-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 25442692 |
| Molecular Formula | C23H27N5O5S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 4-butoxy-3-methoxy-N'-[2-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]benzohydrazide |
| SMILES | CCCCOc1ccc(C(=O)NNC(=O)Cn2c(-c3ccc(OC)cc3)n[nH]c2=S)cc1OC |
| InChI | InChI=1S/C23H27N5O5S/c1-4-5-12-33-18-11-8-16(13-19(18)32-3)22(30)26-24-20(29)14-28-21(25-27-23(28)34)15-6-9-17(31-2)10-7-15/h6-11,13H,4-5,12,14H2,1-3H3,(H,24,29)(H,26,30)(H,27,34) |
| InChIKey | CXNWMTOJXSJIRV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 119.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|