C22H25N5O4S — CID 24553530
3-methoxy-N'-[2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]-4-propoxybenzohydrazide (PubChem CID 24553530) has the molecular formula C22H25N5O4S and a molecular weight of 455.54 g/mol. Its IUPAC name is 3-methoxy-N'-[2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]-4-propoxybenzohydrazide.
| Compound Name | 3-methoxy-N'-[2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]-4-propoxybenzohydrazide |
|---|---|
| PubChem CID | 24553530 |
| Molecular Formula | C22H25N5O4S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 3-methoxy-N'-[2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]-4-propoxybenzohydrazide |
| SMILES | CCCOc1ccc(C(=O)NNC(=O)Cn2c(-c3cccc(C)c3)n[nH]c2=S)cc1OC |
| InChI | InChI=1S/C22H25N5O4S/c1-4-10-31-17-9-8-16(12-18(17)30-3)21(29)25-23-19(28)13-27-20(24-26-22(27)32)15-7-5-6-14(2)11-15/h5-9,11-12H,4,10,13H2,1-3H3,(H,23,28)(H,25,29)(H,26,32) |
| InChIKey | FQGFCEDNLGMVAQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 110.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|