C21H24ClN5OS — CID 55725106
2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[2-(N-ethyl-2-methylanilino)ethyl]acetamide (PubChem CID 55725106) has the molecular formula C21H24ClN5OS and a molecular weight of 429.98 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[2-(N-ethyl-2-methylanilino)ethyl]acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[2-(N-ethyl-2-methylanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 55725106 |
| Molecular Formula | C21H24ClN5OS |
| Molecular Weight | 429.98 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[2-(N-ethyl-2-methylanilino)ethyl]acetamide |
| SMILES | CCN(CCNC(=O)Cn1c(-c2ccc(Cl)cc2)n[nH]c1=S)c1ccccc1C |
| InChI | InChI=1S/C21H24ClN5OS/c1-3-26(18-7-5-4-6-15(18)2)13-12-23-19(28)14-27-20(24-25-21(27)29)16-8-10-17(22)11-9-16/h4-11H,3,12-14H2,1-2H3,(H,23,28)(H,25,29) |
| InChIKey | USZPISFHBWKQPI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 65.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.98 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|