C14H19N5O4S2 — CID 18120612
2-morpholin-4-yl-N'-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]-1,3-thiazole-4-carbohydrazide (PubChem CID 18120612) has the molecular formula C14H19N5O4S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 2-morpholin-4-yl-N'-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-morpholin-4-yl-N'-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 18120612 |
| Molecular Formula | C14H19N5O4S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 2-morpholin-4-yl-N'-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]-1,3-thiazole-4-carbohydrazide |
| SMILES | O=C(CCN1CCSC1=O)NNC(=O)c1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C14H19N5O4S2/c20-11(1-2-19-5-8-24-14(19)22)16-17-12(21)10-9-25-13(15-10)18-3-6-23-7-4-18/h9H,1-8H2,(H,16,20)(H,17,21) |
| InChIKey | PSWZWVHCOCEJKS-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|