C18H25N3O3S — CID 25433378
(3S)-1-cyclopentyl-N'-(5-ethyl-4-methylthiophene-2-carbonyl)-5-oxopyrrolidine-3-carbohydrazide (PubChem CID 25433378) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is (3S)-1-cyclopentyl-N'-(5-ethyl-4-methylthiophene-2-carbonyl)-5-oxopyrrolidine-3-carbohydrazide.
| Compound Name | (3S)-1-cyclopentyl-N'-(5-ethyl-4-methylthiophene-2-carbonyl)-5-oxopyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 25433378 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | (3S)-1-cyclopentyl-N'-(5-ethyl-4-methylthiophene-2-carbonyl)-5-oxopyrrolidine-3-carbohydrazide |
| SMILES | CCc1sc(C(=O)NNC(=O)[C@H]2CC(=O)N(C3CCCC3)C2)cc1C |
| InChI | InChI=1S/C18H25N3O3S/c1-3-14-11(2)8-15(25-14)18(24)20-19-17(23)12-9-16(22)21(10-12)13-6-4-5-7-13/h8,12-13H,3-7,9-10H2,1-2H3,(H,19,23)(H,20,24)/t12-/m0/s1 |
| InChIKey | ILTBLGLGKXSKEO-LBPRGKRZSA-N |
| XLogP | 2.17 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|