C19H22FN3O4S2 — CID 24643981
N'-(5-ethyl-4-methylthiophene-2-carbonyl)-1-(2-fluorophenyl)sulfonylpyrrolidine-2-carbohydrazide (PubChem CID 24643981) has the molecular formula C19H22FN3O4S2 and a molecular weight of 439.53 g/mol. Its IUPAC name is N'-(5-ethyl-4-methylthiophene-2-carbonyl)-1-(2-fluorophenyl)sulfonylpyrrolidine-2-carbohydrazide.
| Compound Name | N'-(5-ethyl-4-methylthiophene-2-carbonyl)-1-(2-fluorophenyl)sulfonylpyrrolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 24643981 |
| Molecular Formula | C19H22FN3O4S2 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | N'-(5-ethyl-4-methylthiophene-2-carbonyl)-1-(2-fluorophenyl)sulfonylpyrrolidine-2-carbohydrazide |
| SMILES | CCc1sc(C(=O)NNC(=O)C2CCCN2S(=O)(=O)c2ccccc2F)cc1C |
| InChI | InChI=1S/C19H22FN3O4S2/c1-3-15-12(2)11-16(28-15)19(25)22-21-18(24)14-8-6-10-23(14)29(26,27)17-9-5-4-7-13(17)20/h4-5,7,9,11,14H,3,6,8,10H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | JCQITGKCQODEKX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|