C22H21FN4O4S2 — CID 24643983
N'-[1-(2-fluorophenyl)sulfonylpyrrolidine-2-carbonyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide (PubChem CID 24643983) has the molecular formula C22H21FN4O4S2 and a molecular weight of 488.57 g/mol. Its IUPAC name is N'-[1-(2-fluorophenyl)sulfonylpyrrolidine-2-carbonyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-[1-(2-fluorophenyl)sulfonylpyrrolidine-2-carbonyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 24643983 |
| Molecular Formula | C22H21FN4O4S2 |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | N'-[1-(2-fluorophenyl)sulfonylpyrrolidine-2-carbonyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)NNC(=O)C1CCCN1S(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C22H21FN4O4S2/c1-14-19(32-22(24-14)15-8-3-2-4-9-15)21(29)26-25-20(28)17-11-7-13-27(17)33(30,31)18-12-6-5-10-16(18)23/h2-6,8-10,12,17H,7,11,13H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | OMJHKVIFGUPEIU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|