C24H24N4O3S — CID 41273695
4-methyl-N'-[(3S)-1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-3-carbonyl]-2-phenyl-1,3-thiazole-5-carbohydrazide (PubChem CID 41273695) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is 4-methyl-N'-[(3S)-1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-3-carbonyl]-2-phenyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | 4-methyl-N'-[(3S)-1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-3-carbonyl]-2-phenyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 41273695 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 4-methyl-N'-[(3S)-1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-3-carbonyl]-2-phenyl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1ccc(CN2C[C@@H](C(=O)NNC(=O)c3sc(-c4ccccc4)nc3C)CC2=O)cc1 |
| InChI | InChI=1S/C24H24N4O3S/c1-15-8-10-17(11-9-15)13-28-14-19(12-20(28)29)22(30)26-27-23(31)21-16(2)25-24(32-21)18-6-4-3-5-7-18/h3-11,19H,12-14H2,1-2H3,(H,26,30)(H,27,31)/t19-/m0/s1 |
| InChIKey | ARFPZUKJIVLYOU-IBGZPJMESA-N |
| XLogP | 3.24 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|