C23H23N5O3 — CID 27688936
N'-[(3S)-1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-3-carbonyl]-3-phenyl-1H-pyrazole-5-carbohydrazide (PubChem CID 27688936) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is N'-[(3S)-1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-3-carbonyl]-3-phenyl-1H-pyrazole-5-carbohydrazide.
| Compound Name | N'-[(3S)-1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-3-carbonyl]-3-phenyl-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 27688936 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | N'-[(3S)-1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-3-carbonyl]-3-phenyl-1H-pyrazole-5-carbohydrazide |
| SMILES | Cc1ccc(CN2C[C@@H](C(=O)NNC(=O)c3cc(-c4ccccc4)n[nH]3)CC2=O)cc1 |
| InChI | InChI=1S/C23H23N5O3/c1-15-7-9-16(10-8-15)13-28-14-18(11-21(28)29)22(30)26-27-23(31)20-12-19(24-25-20)17-5-3-2-4-6-17/h2-10,12,18H,11,13-14H2,1H3,(H,24,25)(H,26,30)(H,27,31)/t18-/m0/s1 |
| InChIKey | HGCRZKMIOBJASI-SFHVURJKSA-N |
| XLogP | 2.19 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|