C18H20N4O3 — CID 78814266
N'-[1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-3-carbonyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 78814266) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is N'-[1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-3-carbonyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | N'-[1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-3-carbonyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 78814266 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N'-[1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-3-carbonyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | Cc1ccc(CN2CC(C(=O)NNC(=O)c3ccc[nH]3)CC2=O)cc1 |
| InChI | InChI=1S/C18H20N4O3/c1-12-4-6-13(7-5-12)10-22-11-14(9-16(22)23)17(24)20-21-18(25)15-3-2-8-19-15/h2-8,14,19H,9-11H2,1H3,(H,20,24)(H,21,25) |
| InChIKey | KURQVQPBPOCJSY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|