C17H18N4O3 — CID 78812975
N'-[1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 78812975) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is N'-[1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | N'-[1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 78812975 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N'-[1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | Cc1ccc(N2CC(C(=O)NNC(=O)c3ccc[nH]3)CC2=O)cc1 |
| InChI | InChI=1S/C17H18N4O3/c1-11-4-6-13(7-5-11)21-10-12(9-15(21)22)16(23)19-20-17(24)14-3-2-8-18-14/h2-8,12,18H,9-10H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | VCJRNLWENMKWSJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|