C20H24N4O3 — CID 78814263
N'-[1-(2-butan-2-ylphenyl)-5-oxopyrrolidine-3-carbonyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 78814263) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is N'-[1-(2-butan-2-ylphenyl)-5-oxopyrrolidine-3-carbonyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | N'-[1-(2-butan-2-ylphenyl)-5-oxopyrrolidine-3-carbonyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 78814263 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N'-[1-(2-butan-2-ylphenyl)-5-oxopyrrolidine-3-carbonyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | CCC(C)c1ccccc1N1CC(C(=O)NNC(=O)c2ccc[nH]2)CC1=O |
| InChI | InChI=1S/C20H24N4O3/c1-3-13(2)15-7-4-5-9-17(15)24-12-14(11-18(24)25)19(26)22-23-20(27)16-8-6-10-21-16/h4-10,13-14,21H,3,11-12H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | VIUHUNMXWMEQDS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|