C22H31N3O3 — CID 51181758
1-(2-butan-2-ylphenyl)-5-oxo-N-(3-oxo-3-pyrrolidin-1-ylpropyl)pyrrolidine-3-carboxamide (PubChem CID 51181758) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is 1-(2-butan-2-ylphenyl)-5-oxo-N-(3-oxo-3-pyrrolidin-1-ylpropyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(2-butan-2-ylphenyl)-5-oxo-N-(3-oxo-3-pyrrolidin-1-ylpropyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 51181758 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 1-(2-butan-2-ylphenyl)-5-oxo-N-(3-oxo-3-pyrrolidin-1-ylpropyl)pyrrolidine-3-carboxamide |
| SMILES | CCC(C)c1ccccc1N1CC(C(=O)NCCC(=O)N2CCCC2)CC1=O |
| InChI | InChI=1S/C22H31N3O3/c1-3-16(2)18-8-4-5-9-19(18)25-15-17(14-21(25)27)22(28)23-11-10-20(26)24-12-6-7-13-24/h4-5,8-9,16-17H,3,6-7,10-15H2,1-2H3,(H,23,28) |
| InChIKey | URKJPCWCQYHOQD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |