C27H33N3O3 — CID 55333082
1-(2-butan-2-ylphenyl)-5-oxo-N-[2-(piperidine-1-carbonyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 55333082) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is 1-(2-butan-2-ylphenyl)-5-oxo-N-[2-(piperidine-1-carbonyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(2-butan-2-ylphenyl)-5-oxo-N-[2-(piperidine-1-carbonyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55333082 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 1-(2-butan-2-ylphenyl)-5-oxo-N-[2-(piperidine-1-carbonyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | CCC(C)c1ccccc1N1CC(C(=O)Nc2ccccc2C(=O)N2CCCCC2)CC1=O |
| InChI | InChI=1S/C27H33N3O3/c1-3-19(2)21-11-6-8-14-24(21)30-18-20(17-25(30)31)26(32)28-23-13-7-5-12-22(23)27(33)29-15-9-4-10-16-29/h5-8,11-14,19-20H,3-4,9-10,15-18H2,1-2H3,(H,28,32) |
| InChIKey | PYUDRFIEJOVTKL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |