C22H20N4O3 — CID 55346229
N'-[1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]quinoline-2-carbohydrazide (PubChem CID 55346229) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is N'-[1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]quinoline-2-carbohydrazide.
| Compound Name | N'-[1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]quinoline-2-carbohydrazide |
|---|---|
| PubChem CID | 55346229 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | N'-[1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]quinoline-2-carbohydrazide |
| SMILES | Cc1ccc(N2CC(C(=O)NNC(=O)c3ccc4ccccc4n3)CC2=O)cc1 |
| InChI | InChI=1S/C22H20N4O3/c1-14-6-9-17(10-7-14)26-13-16(12-20(26)27)21(28)24-25-22(29)19-11-8-15-4-2-3-5-18(15)23-19/h2-11,16H,12-13H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | VQAKJWHJAYYOEU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|