C21H24N4O3S — CID 25439328
N'-[1-(cyclopropanecarbonyl)piperidine-4-carbonyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide (PubChem CID 25439328) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is N'-[1-(cyclopropanecarbonyl)piperidine-4-carbonyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-[1-(cyclopropanecarbonyl)piperidine-4-carbonyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 25439328 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N'-[1-(cyclopropanecarbonyl)piperidine-4-carbonyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)NNC(=O)C1CCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C21H24N4O3S/c1-13-17(29-20(22-13)15-5-3-2-4-6-15)19(27)24-23-18(26)14-9-11-25(12-10-14)21(28)16-7-8-16/h2-6,14,16H,7-12H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | DBXBJTVGOMCOLA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|