C19H25N3O3S — CID 51932924
(3R)-1-cyclopropyl-N'-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)-5-oxopyrrolidine-3-carbohydrazide (PubChem CID 51932924) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is (3R)-1-cyclopropyl-N'-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)-5-oxopyrrolidine-3-carbohydrazide.
| Compound Name | (3R)-1-cyclopropyl-N'-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)-5-oxopyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 51932924 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (3R)-1-cyclopropyl-N'-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)-5-oxopyrrolidine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)[C@@H]1CC(=O)N(C2CC2)C1)c1cc2c(s1)CCCCCC2 |
| InChI | InChI=1S/C19H25N3O3S/c23-17-10-13(11-22(17)14-7-8-14)18(24)20-21-19(25)16-9-12-5-3-1-2-4-6-15(12)26-16/h9,13-14H,1-8,10-11H2,(H,20,24)(H,21,25)/t13-/m1/s1 |
| InChIKey | PISZYDQPUBRIKK-CYBMUJFWSA-N |
| XLogP | 2.18 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|