C24H29N3O4S — CID 55634767
1-(2-phenoxyacetyl)-N'-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)piperidine-4-carbohydrazide (PubChem CID 55634767) has the molecular formula C24H29N3O4S and a molecular weight of 455.58 g/mol. Its IUPAC name is 1-(2-phenoxyacetyl)-N'-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)piperidine-4-carbohydrazide.
| Compound Name | 1-(2-phenoxyacetyl)-N'-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 55634767 |
| Molecular Formula | C24H29N3O4S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 1-(2-phenoxyacetyl)-N'-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)piperidine-4-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCN(C(=O)COc2ccccc2)CC1)c1cc2c(s1)CCCCC2 |
| InChI | InChI=1S/C24H29N3O4S/c28-22(16-31-19-8-4-2-5-9-19)27-13-11-17(12-14-27)23(29)25-26-24(30)21-15-18-7-3-1-6-10-20(18)32-21/h2,4-5,8-9,15,17H,1,3,6-7,10-14,16H2,(H,25,29)(H,26,30) |
| InChIKey | YUUSYDYGXDUGSM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|