C22H23N3O6 — CID 55631373
N'-(1,3-benzodioxole-5-carbonyl)-1-(2-phenoxyacetyl)piperidine-4-carbohydrazide (PubChem CID 55631373) has the molecular formula C22H23N3O6 and a molecular weight of 425.44 g/mol. Its IUPAC name is N'-(1,3-benzodioxole-5-carbonyl)-1-(2-phenoxyacetyl)piperidine-4-carbohydrazide.
| Compound Name | N'-(1,3-benzodioxole-5-carbonyl)-1-(2-phenoxyacetyl)piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 55631373 |
| Molecular Formula | C22H23N3O6 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N'-(1,3-benzodioxole-5-carbonyl)-1-(2-phenoxyacetyl)piperidine-4-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCN(C(=O)COc2ccccc2)CC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H23N3O6/c26-20(13-29-17-4-2-1-3-5-17)25-10-8-15(9-11-25)21(27)23-24-22(28)16-6-7-18-19(12-16)31-14-30-18/h1-7,12,15H,8-11,13-14H2,(H,23,27)(H,24,28) |
| InChIKey | WQUQVFDGTYCJMY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|