C18H27N3O4S2 — CID 26040079
N'-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)-1-methylsulfonylpiperidine-4-carbohydrazide (PubChem CID 26040079) has the molecular formula C18H27N3O4S2 and a molecular weight of 413.57 g/mol. Its IUPAC name is N'-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)-1-methylsulfonylpiperidine-4-carbohydrazide.
| Compound Name | N'-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)-1-methylsulfonylpiperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 26040079 |
| Molecular Formula | C18H27N3O4S2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N'-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)-1-methylsulfonylpiperidine-4-carbohydrazide |
| SMILES | CS(=O)(=O)N1CCC(C(=O)NNC(=O)c2cc3c(s2)CCCCCC3)CC1 |
| InChI | InChI=1S/C18H27N3O4S2/c1-27(24,25)21-10-8-13(9-11-21)17(22)19-20-18(23)16-12-14-6-4-2-3-5-7-15(14)26-16/h12-13H,2-11H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | OUOMVSCRGIWMGL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|