C24H30N2O2S — CID 41305146
N-benzyl-1-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)piperidine-4-carboxamide (PubChem CID 41305146) has the molecular formula C24H30N2O2S and a molecular weight of 410.58 g/mol. Its IUPAC name is N-benzyl-1-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-benzyl-1-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 41305146 |
| Molecular Formula | C24H30N2O2S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-benzyl-1-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1CCN(C(=O)c2cc3c(s2)CCCCCC3)CC1 |
| InChI | InChI=1S/C24H30N2O2S/c27-23(25-17-18-8-4-3-5-9-18)19-12-14-26(15-13-19)24(28)22-16-20-10-6-1-2-7-11-21(20)29-22/h3-5,8-9,16,19H,1-2,6-7,10-15,17H2,(H,25,27) |
| InChIKey | KEWBGMHLHXVEGS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |