C17H13ClFN5O2S — CID 55310864
2-chloro-N'-[2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide (PubChem CID 55310864) has the molecular formula C17H13ClFN5O2S and a molecular weight of 405.84 g/mol. Its IUPAC name is 2-chloro-N'-[2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide.
| Compound Name | 2-chloro-N'-[2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 55310864 |
| Molecular Formula | C17H13ClFN5O2S |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 2-chloro-N'-[2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide |
| SMILES | O=C(CSc1n[nH]c(-c2ccccc2F)n1)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C17H13ClFN5O2S/c18-12-7-3-1-5-10(12)16(26)23-21-14(25)9-27-17-20-15(22-24-17)11-6-2-4-8-13(11)19/h1-8H,9H2,(H,21,25)(H,23,26)(H,20,22,24) |
| InChIKey | XUDJOAWANSMDHX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|