C16H15F3N4O3 — CID 119349202
1-[1-[3-(trifluoromethyl)phenyl]triazole-4-carbonyl]piperidine-4-carboxylic acid (PubChem CID 119349202) has the molecular formula C16H15F3N4O3 and a molecular weight of 368.32 g/mol. Its IUPAC name is 1-[1-[3-(trifluoromethyl)phenyl]triazole-4-carbonyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[1-[3-(trifluoromethyl)phenyl]triazole-4-carbonyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119349202 |
| Molecular Formula | C16H15F3N4O3 |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 1-[1-[3-(trifluoromethyl)phenyl]triazole-4-carbonyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)c2cn(-c3cccc(C(F)(F)F)c3)nn2)CC1 |
| InChI | InChI=1S/C16H15F3N4O3/c17-16(18,19)11-2-1-3-12(8-11)23-9-13(20-21-23)14(24)22-6-4-10(5-7-22)15(25)26/h1-3,8-10H,4-7H2,(H,25,26) |
| InChIKey | STLDSTMKEREJNG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |