C16H14F3N3O3 — CID 119353697
1-[1-[3-(trifluoromethyl)phenyl]pyrazole-3-carbonyl]pyrrolidine-3-carboxylic acid (PubChem CID 119353697) has the molecular formula C16H14F3N3O3 and a molecular weight of 353.30 g/mol. Its IUPAC name is 1-[1-[3-(trifluoromethyl)phenyl]pyrazole-3-carbonyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[1-[3-(trifluoromethyl)phenyl]pyrazole-3-carbonyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119353697 |
| Molecular Formula | C16H14F3N3O3 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 1-[1-[3-(trifluoromethyl)phenyl]pyrazole-3-carbonyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)c2ccn(-c3cccc(C(F)(F)F)c3)n2)C1 |
| InChI | InChI=1S/C16H14F3N3O3/c17-16(18,19)11-2-1-3-12(8-11)22-7-5-13(20-22)14(23)21-6-4-10(9-21)15(24)25/h1-3,5,7-8,10H,4,6,9H2,(H,24,25) |
| InChIKey | OWZAPUSWLJELMC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |