C16H16F3N3O2 — CID 111435912
(3-hydroxypiperidin-1-yl)-[1-[3-(trifluoromethyl)phenyl]pyrazol-3-yl]methanone (PubChem CID 111435912) has the molecular formula C16H16F3N3O2 and a molecular weight of 339.32 g/mol. Its IUPAC name is (3-hydroxypiperidin-1-yl)-[1-[3-(trifluoromethyl)phenyl]pyrazol-3-yl]methanone.
| Compound Name | (3-hydroxypiperidin-1-yl)-[1-[3-(trifluoromethyl)phenyl]pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 111435912 |
| Molecular Formula | C16H16F3N3O2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | (3-hydroxypiperidin-1-yl)-[1-[3-(trifluoromethyl)phenyl]pyrazol-3-yl]methanone |
| SMILES | O=C(c1ccn(-c2cccc(C(F)(F)F)c2)n1)N1CCCC(O)C1 |
| InChI | InChI=1S/C16H16F3N3O2/c17-16(18,19)11-3-1-4-12(9-11)22-8-6-14(20-22)15(24)21-7-2-5-13(23)10-21/h1,3-4,6,8-9,13,23H,2,5,7,10H2 |
| InChIKey | DDMRBWPMVSASSS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |