C14H16ClFN4O2 — CID 84596860
1-(3-chloro-2-fluorophenyl)-N-(4-hydroxy-2-methylbutyl)triazole-4-carboxamide (PubChem CID 84596860) has the molecular formula C14H16ClFN4O2 and a molecular weight of 326.76 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)-N-(4-hydroxy-2-methylbutyl)triazole-4-carboxamide.
| Compound Name | 1-(3-chloro-2-fluorophenyl)-N-(4-hydroxy-2-methylbutyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 84596860 |
| Molecular Formula | C14H16ClFN4O2 |
| Molecular Weight | 326.76 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)-N-(4-hydroxy-2-methylbutyl)triazole-4-carboxamide |
| SMILES | CC(CCO)CNC(=O)c1cn(-c2cccc(Cl)c2F)nn1 |
| InChI | InChI=1S/C14H16ClFN4O2/c1-9(5-6-21)7-17-14(22)11-8-20(19-18-11)12-4-2-3-10(15)13(12)16/h2-4,8-9,21H,5-7H2,1H3,(H,17,22) |
| InChIKey | HMHDVVYGTDAPBT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.76 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |