C6H10N4O3S — CID 61067022
N-(2-sulfamoylethyl)-1H-pyrazole-5-carboxamide (PubChem CID 61067022) has the molecular formula C6H10N4O3S and a molecular weight of 218.24 g/mol. Its IUPAC name is N-(2-sulfamoylethyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-(2-sulfamoylethyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 61067022 |
| Molecular Formula | C6H10N4O3S |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | N-(2-sulfamoylethyl)-1H-pyrazole-5-carboxamide |
| SMILES | NS(=O)(=O)CCNC(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C6H10N4O3S/c7-14(12,13)4-3-8-6(11)5-1-2-9-10-5/h1-2H,3-4H2,(H,8,11)(H,9,10)(H2,7,12,13) |
| InChIKey | ZTPUVDOZAGCWMV-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |