C12H12ClN3O3S — CID 63084257
4-[2-(1H-pyrazole-5-carbonylamino)ethyl]benzenesulfonyl chloride (PubChem CID 63084257) has the molecular formula C12H12ClN3O3S and a molecular weight of 313.77 g/mol. Its IUPAC name is 4-[2-(1H-pyrazole-5-carbonylamino)ethyl]benzenesulfonyl chloride.
| Compound Name | 4-[2-(1H-pyrazole-5-carbonylamino)ethyl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 63084257 |
| Molecular Formula | C12H12ClN3O3S |
| Molecular Weight | 313.77 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 4-[2-(1H-pyrazole-5-carbonylamino)ethyl]benzenesulfonyl chloride |
| SMILES | O=C(NCCc1ccc(S(=O)(=O)Cl)cc1)c1ccn[nH]1 |
| InChI | InChI=1S/C12H12ClN3O3S/c13-20(18,19)10-3-1-9(2-4-10)5-7-14-12(17)11-6-8-15-16-11/h1-4,6,8H,5,7H2,(H,14,17)(H,15,16) |
| InChIKey | MITCLYNDGAJMIF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.77 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |