C17H17N5O3S — CID 110676548
3-pyridin-4-yl-N-[2-(4-sulfamoylphenyl)ethyl]-1H-pyrazole-5-carboxamide (PubChem CID 110676548) has the molecular formula C17H17N5O3S and a molecular weight of 371.42 g/mol. Its IUPAC name is 3-pyridin-4-yl-N-[2-(4-sulfamoylphenyl)ethyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-pyridin-4-yl-N-[2-(4-sulfamoylphenyl)ethyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 110676548 |
| Molecular Formula | C17H17N5O3S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 3-pyridin-4-yl-N-[2-(4-sulfamoylphenyl)ethyl]-1H-pyrazole-5-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)c2cc(-c3ccncc3)n[nH]2)cc1 |
| InChI | InChI=1S/C17H17N5O3S/c18-26(24,25)14-3-1-12(2-4-14)5-10-20-17(23)16-11-15(21-22-16)13-6-8-19-9-7-13/h1-4,6-9,11H,5,10H2,(H,20,23)(H,21,22)(H2,18,24,25) |
| InChIKey | REXQBAHJKSFZEL-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |